Ginkgolic acid C17:1
Numer katalogowy: 931-T6S2116-50mg
Sprzedawca: Gentaur
Rozmiar: 50mg
Dostępność: Na zamówienie
Cena: 0.01 PLN*
* Cena orientacyjna netto, bez kosztów transportu. Skontaktuj się z nami, aby otrzymać aktualną ofertę w 24h.
Mogą Cię zainteresować
Ginkgolic acid C17:1
Dodatkowe informacje:
- SMILES: CCCCCC\C=C/CCCCCCCCCc1cccc(O)c1C(O)=O
- Formula: C24H38O3
Specyfikacja/Zawartość:
- Purity: 0.9981
- CAS#: 111047-30-4
- Molecular Weight: 374.565
- Bioactivity: 1. Ginkgolic acid C17:1 can significantly inhibit enterohemorrhagic Escherichia coli O157:H7(EHEC) biofilm formation on the surfaces of polystyrene and glass, and on nylon membranes.
Inne:
For research use only.
0 opinie o Ginkgolic acid C17:1